C25H34N7O9P — CID 90692679
3-[[2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide (PubChem CID 90692679) has the molecular formula C25H34N7O9P and a molecular weight of 607.56 g/mol. Its IUPAC name is 3-[[2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide.
| Compound Name | 3-[[2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 90692679 |
| Molecular Formula | C25H34N7O9P |
| Molecular Weight | 607.56 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 3-[[2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCNC(=O)C(O)[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1)OCC |
| InChI | InChI=1S/C25H34N7O9P/c1-3-39-42(38,40-4-2)11-14-5-7-15(8-6-14)31-16(33)9-10-27-24(37)20(36)21-18(34)19(35)25(41-21)32-13-30-17-22(26)28-12-29-23(17)32/h5-8,12-13,18-21,25,34-36H,3-4,9-11H2,1-2H3,(H,27,37)(H,31,33)(H2,26,28,29)/t18-,19+,20?,21-,25+/m0/s1 |
| InChIKey | KXJFLFMVKOLDGQ-XGLMYJAPSA-N |
| XLogP | 0.30 |
| TPSA | 233.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.56 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|