C28H32N8O6 — CID 22851632
N-(2-aminoethyl)-2-[4-[[2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phenyl]acetyl]amino]phenyl]acetamide (PubChem CID 22851632) has the molecular formula C28H32N8O6 and a molecular weight of 576.61 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-[[2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phenyl]acetyl]amino]phenyl]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[4-[[2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phenyl]acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 22851632 |
| Molecular Formula | C28H32N8O6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-[[2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phenyl]acetyl]amino]phenyl]acetamide |
| SMILES | NCCNC(=O)Cc1ccc(NC(=O)Cc2ccc(OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)cc2)cc1 |
| InChI | InChI=1S/C28H32N8O6/c29-9-10-31-21(37)11-16-1-5-18(6-2-16)35-22(38)12-17-3-7-19(8-4-17)41-13-20-24(39)25(40)28(42-20)36-15-34-23-26(30)32-14-33-27(23)36/h1-8,14-15,20,24-25,28,39-40H,9-13,29H2,(H,31,37)(H,35,38)(H2,30,32,33)/t20-,24-,25-,28-/m1/s1 |
| InChIKey | RLOMSPOYAWBRNU-QZHHGCDDSA-N |
| XLogP | -0.09 |
| TPSA | 212.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |