C26H37N7O4 — CID 130228092
N-[3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-2-(4-tert-butylphenyl)acetamide (PubChem CID 130228092) has the molecular formula C26H37N7O4 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-2-(4-tert-butylphenyl)acetamide.
| Compound Name | N-[3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-2-(4-tert-butylphenyl)acetamide |
|---|---|
| PubChem CID | 130228092 |
| Molecular Formula | C26H37N7O4 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | N-[3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-2-(4-tert-butylphenyl)acetamide |
| SMILES | CN(CCCNC(=O)Cc1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C26H37N7O4/c1-26(2,3)17-8-6-16(7-9-17)12-19(34)28-10-5-11-32(4)13-18-21(35)22(36)25(37-18)33-15-31-20-23(27)29-14-30-24(20)33/h6-9,14-15,18,21-22,25,35-36H,5,10-13H2,1-4H3,(H,28,34)(H2,27,29,30)/t18-,21?,22?,25-/m1/s1 |
| InChIKey | JHAHYPJLVZVQQB-CISKAWLMSA-N |
| XLogP | 1.01 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|