C14H24N8O8S — CID 66855008
3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propanehydrazide;sulfuric acid (PubChem CID 66855008) has the molecular formula C14H24N8O8S and a molecular weight of 464.46 g/mol. Its IUPAC name is 3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propanehydrazide;sulfuric acid.
| Compound Name | 3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propanehydrazide;sulfuric acid |
|---|---|
| PubChem CID | 66855008 |
| Molecular Formula | C14H24N8O8S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propanehydrazide;sulfuric acid |
| SMILES | CN(CCC(=O)NN)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O.O=S(=O)(O)O |
| InChI | InChI=1S/C14H22N8O4.H2O4S/c1-21(3-2-8(23)20-16)4-7-10(24)11(25)14(26-7)22-6-19-9-12(15)17-5-18-13(9)22;1-5(2,3)4/h5-7,10-11,14,24-25H,2-4,16H2,1H3,(H,20,23)(H2,15,17,18);(H2,1,2,3,4)/t7-,10?,11?,14-;/m1./s1 |
| InChIKey | XYYUFPHISXSTMQ-DNNXCHFVSA-N |
| XLogP | -3.31 |
| TPSA | 252.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|