C13H18N6O4 — CID 66601547
2-[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide (PubChem CID 66601547) has the molecular formula C13H18N6O4 and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide.
| Compound Name | 2-[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 66601547 |
| Molecular Formula | C13H18N6O4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C13H18N6O4/c1-2-15-7(20)3-6-9(21)10(22)13(23-6)19-5-18-8-11(14)16-4-17-12(8)19/h4-6,9-10,13,21-22H,2-3H2,1H3,(H,15,20)(H2,14,16,17)/t6-,9?,10?,13-/m1/s1 |
| InChIKey | DQORMIATPKNWHI-ZYZAPTCBSA-N |
| XLogP | -1.45 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |