C12H16N6O3S — CID 14157149
5-(6-aminopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carbothioamide (PubChem CID 14157149) has the molecular formula C12H16N6O3S and a molecular weight of 324.37 g/mol. Its IUPAC name is 5-(6-aminopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carbothioamide.
| Compound Name | 5-(6-aminopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carbothioamide |
|---|---|
| PubChem CID | 14157149 |
| Molecular Formula | C12H16N6O3S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 5-(6-aminopurin-9-yl)-N-ethyl-3,4-dihydroxyoxolane-2-carbothioamide |
| SMILES | CCNC(=S)C1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C12H16N6O3S/c1-2-14-11(22)8-6(19)7(20)12(21-8)18-4-17-5-9(13)15-3-16-10(5)18/h3-4,6-8,12,19-20H,2H2,1H3,(H,14,22)(H2,13,15,16) |
| InChIKey | CZEWXDICHLHNGI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|