C16H24N8O5 — CID 167462165
(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(ethylcarbamoylamino)propyl]-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 167462165) has the molecular formula C16H24N8O5 and a molecular weight of 408.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(ethylcarbamoylamino)propyl]-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(ethylcarbamoylamino)propyl]-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 167462165 |
| Molecular Formula | C16H24N8O5 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(ethylcarbamoylamino)propyl]-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)NCCCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H24N8O5/c1-2-18-16(28)20-5-3-4-19-14(27)11-9(25)10(26)15(29-11)24-7-23-8-12(17)21-6-22-13(8)24/h6-7,9-11,15,25-26H,2-5H2,1H3,(H,19,27)(H2,17,21,22)(H2,18,20,28)/t9-,10+,11-,15+/m0/s1 |
| InChIKey | TXIKPFNHBFDUCC-BQVMBELUSA-N |
| XLogP | -2.15 |
| TPSA | 189.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|