C22H37N7O11P2 — CID 59441550
(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-[bis(diethoxyphosphoryl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 59441550) has the molecular formula C22H37N7O11P2 and a molecular weight of 637.52 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-[bis(diethoxyphosphoryl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-[bis(diethoxyphosphoryl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 59441550 |
| Molecular Formula | C22H37N7O11P2 |
| Molecular Weight | 637.52 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-[bis(diethoxyphosphoryl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H37N7O11P2/c1-5-36-41(34,37-6-2)22(42(35,38-7-3)39-8-4)28-13(30)9-10-24-20(33)17-15(31)16(32)21(40-17)29-12-27-14-18(23)25-11-26-19(14)29/h11-12,15-17,21-22,31-32H,5-10H2,1-4H3,(H,24,33)(H,28,30)(H2,23,25,26)/t15-,16+,17-,21+/m0/s1 |
| InChIKey | NDNRHJYBLMNMPY-GRXQJBFDSA-N |
| XLogP | 0.47 |
| TPSA | 248.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.52 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|