C18H28N7O8P — CID 24949232
(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(diethoxyphosphorylmethylamino)-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 24949232) has the molecular formula C18H28N7O8P and a molecular weight of 501.44 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(diethoxyphosphorylmethylamino)-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(diethoxyphosphorylmethylamino)-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 24949232 |
| Molecular Formula | C18H28N7O8P |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-N-[3-(diethoxyphosphorylmethylamino)-3-oxopropyl]-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCOP(=O)(CNC(=O)CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C18H28N7O8P/c1-3-31-34(30,32-4-2)9-24-10(26)5-6-20-17(29)14-12(27)13(28)18(33-14)25-8-23-11-15(19)21-7-22-16(11)25/h7-8,12-14,18,27-28H,3-6,9H2,1-2H3,(H,20,29)(H,24,26)(H2,19,21,22)/t12-,13+,14-,18+/m0/s1 |
| InChIKey | VDWAZYKFEXMRMW-MOROJQBDSA-N |
| XLogP | -1.13 |
| TPSA | 213.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|