C11H14N6O5 — CID 131852589
(2S,3S,4S,5R,6R)-6-(6-aminopurin-9-yl)-3,4,5-trihydroxyoxane-2-carboxamide (PubChem CID 131852589) has the molecular formula C11H14N6O5 and a molecular weight of 310.27 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-(6-aminopurin-9-yl)-3,4,5-trihydroxyoxane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R,6R)-6-(6-aminopurin-9-yl)-3,4,5-trihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 131852589 |
| Molecular Formula | C11H14N6O5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-(6-aminopurin-9-yl)-3,4,5-trihydroxyoxane-2-carboxamide |
| SMILES | NC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H14N6O5/c12-8-3-10(15-1-14-8)17(2-16-3)11-6(20)4(18)5(19)7(22-11)9(13)21/h1-2,4-7,11,18-20H,(H2,13,21)(H2,12,14,15)/t4-,5-,6+,7-,11+/m0/s1 |
| InChIKey | FEPGTBWMHXJGJG-PWLNLMJCSA-N |
| XLogP | -3.13 |
| TPSA | 182.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |