C12H16N6O4 — CID 46874719
3-[(2R,3S,4S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propanamide (PubChem CID 46874719) has the molecular formula C12H16N6O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-[(2R,3S,4S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propanamide.
| Compound Name | 3-[(2R,3S,4S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 46874719 |
| Molecular Formula | C12H16N6O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[(2R,3S,4S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propanamide |
| SMILES | NC(=O)CC[C@H]1OC(n2cnc3c(N)ncnc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16N6O4/c13-6(19)2-1-5-8(20)9(21)12(22-5)18-4-17-7-10(14)15-3-16-11(7)18/h3-5,8-9,12,20-21H,1-2H2,(H2,13,19)(H2,14,15,16)/t5-,8-,9+,12?/m1/s1 |
| InChIKey | SZFQYQMJPSTSHP-BPOSCCBFSA-N |
| XLogP | -1.71 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |