C14H17N5O6 — CID 91081072
5-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxopentanoic acid (PubChem CID 91081072) has the molecular formula C14H17N5O6 and a molecular weight of 351.32 g/mol. Its IUPAC name is 5-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxopentanoic acid.
| Compound Name | 5-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxopentanoic acid |
|---|---|
| PubChem CID | 91081072 |
| Molecular Formula | C14H17N5O6 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxopentanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CCCC(=O)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17N5O6/c15-11-8-12(17-4-16-11)19(5-18-8)13-10(22)9(21)7(25-13)3-1-2-6(20)14(23)24/h4-5,7,9-10,13,21-22H,1-3H2,(H,23,24)(H2,15,16,17)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | MJRBERVYGSHKBL-QYVSTXNMSA-N |
| XLogP | -1.15 |
| TPSA | 173.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|