C12H14F2N5O5- — CID 160760555
(2R,5S)-2-(6-aminopurin-9-yl)-5-(fluoromethyl)oxolane-3,4-diol;2-fluoroacetate (PubChem CID 160760555) has the molecular formula C12H14F2N5O5- and a molecular weight of 346.27 g/mol. Its IUPAC name is (2R,5S)-2-(6-aminopurin-9-yl)-5-(fluoromethyl)oxolane-3,4-diol;2-fluoroacetate.
| Compound Name | (2R,5S)-2-(6-aminopurin-9-yl)-5-(fluoromethyl)oxolane-3,4-diol;2-fluoroacetate |
|---|---|
| PubChem CID | 160760555 |
| Molecular Formula | C12H14F2N5O5- |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (2R,5S)-2-(6-aminopurin-9-yl)-5-(fluoromethyl)oxolane-3,4-diol;2-fluoroacetate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CF)C(O)C1O.O=C([O-])CF |
| InChI | InChI=1S/C10H12FN5O3.C2H3FO2/c11-1-4-6(17)7(18)10(19-4)16-3-15-5-8(12)13-2-14-9(5)16;3-1-2(4)5/h2-4,6-7,10,17-18H,1H2,(H2,12,13,14);1H2,(H,4,5)/p-1/t4-,6?,7?,10-;/m1./s1 |
| InChIKey | RXZWCIRYENTOIU-DMKJTNOUSA-M |
| XLogP | -2.30 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |