C21H29N7O4 — CID 130214940
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[2-(4-hydroxyphenyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol (PubChem CID 130214940) has the molecular formula C21H29N7O4 and a molecular weight of 443.51 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[2-(4-hydroxyphenyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[2-(4-hydroxyphenyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130214940 |
| Molecular Formula | C21H29N7O4 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[2-(4-hydroxyphenyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol |
| SMILES | CN(CCNCCc1ccc(O)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H29N7O4/c1-27(9-8-23-7-6-13-2-4-14(29)5-3-13)10-15-17(30)18(31)21(32-15)28-12-26-16-19(22)24-11-25-20(16)28/h2-5,11-12,15,17-18,21,23,29-31H,6-10H2,1H3,(H2,22,24,25)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | DJRTZCGKGQYRJZ-QTQZEZTPSA-N |
| XLogP | -0.50 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|