C27H32ClN7O3 — CID 130214947
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[benzyl-[2-[2-(4-chlorophenyl)ethylamino]ethyl]amino]methyl]oxolane-3,4-diol (PubChem CID 130214947) has the molecular formula C27H32ClN7O3 and a molecular weight of 538.05 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[benzyl-[2-[2-(4-chlorophenyl)ethylamino]ethyl]amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[benzyl-[2-[2-(4-chlorophenyl)ethylamino]ethyl]amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130214947 |
| Molecular Formula | C27H32ClN7O3 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[benzyl-[2-[2-(4-chlorophenyl)ethylamino]ethyl]amino]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CCNCCc2ccc(Cl)cc2)Cc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32ClN7O3/c28-20-8-6-18(7-9-20)10-11-30-12-13-34(14-19-4-2-1-3-5-19)15-21-23(36)24(37)27(38-21)35-17-33-22-25(29)31-16-32-26(22)35/h1-9,16-17,21,23-24,27,30,36-37H,10-15H2,(H2,29,31,32)/t21-,23-,24-,27-/m1/s1 |
| InChIKey | SXFXNAGRQQFSJA-VBHAUSMQSA-N |
| XLogP | 2.02 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|