C23H30N8O5 — CID 155535125
3-[[(5-amino-5-oxopentyl)-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]amino]methyl]benzamide (PubChem CID 155535125) has the molecular formula C23H30N8O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is 3-[[(5-amino-5-oxopentyl)-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]amino]methyl]benzamide.
| Compound Name | 3-[[(5-amino-5-oxopentyl)-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 155535125 |
| Molecular Formula | C23H30N8O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-[[(5-amino-5-oxopentyl)-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]amino]methyl]benzamide |
| SMILES | NC(=O)CCCCN(Cc1cccc(C(N)=O)c1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H30N8O5/c24-16(32)6-1-2-7-30(9-13-4-3-5-14(8-13)21(26)35)10-15-18(33)19(34)23(36-15)31-12-29-17-20(25)27-11-28-22(17)31/h3-5,8,11-12,15,18-19,23,33-34H,1-2,6-7,9-10H2,(H2,24,32)(H2,26,35)(H2,25,27,28)/t15-,18-,19-,23-/m1/s1 |
| InChIKey | PVUVRTPQYDNGFS-VZKMNXCRSA-N |
| XLogP | -0.72 |
| TPSA | 208.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|