C22H28N6O5 — CID 164620233
4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-phenylethyl)amino]butanoic acid (PubChem CID 164620233) has the molecular formula C22H28N6O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-phenylethyl)amino]butanoic acid.
| Compound Name | 4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-phenylethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 164620233 |
| Molecular Formula | C22H28N6O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-phenylethyl)amino]butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CCCC(=O)O)CCc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H28N6O5/c23-20-17-21(25-12-24-20)28(13-26-17)22-19(32)18(31)15(33-22)11-27(9-4-7-16(29)30)10-8-14-5-2-1-3-6-14/h1-3,5-6,12-13,15,18-19,22,31-32H,4,7-11H2,(H,29,30)(H2,23,24,25)/t15-,18-,19-,22-/m1/s1 |
| InChIKey | ZPFKXVRNNUUVMN-CIVUBGFFSA-N |
| XLogP | 0.44 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |