C22H26F3N7O5 — CID 171344156
(2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]butanoic acid (PubChem CID 171344156) has the molecular formula C22H26F3N7O5 and a molecular weight of 525.49 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 171344156 |
| Molecular Formula | C22H26F3N7O5 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CC[C@H](N)C(=O)O)Cc2ccc(C(F)(F)F)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26F3N7O5/c23-22(24,25)12-3-1-11(2-4-12)7-31(6-5-13(26)21(35)36)8-14-16(33)17(34)20(37-14)32-10-30-15-18(27)28-9-29-19(15)32/h1-4,9-10,13-14,16-17,20,33-34H,5-8,26H2,(H,35,36)(H2,27,28,29)/t13-,14+,16+,17+,20+/m0/s1 |
| InChIKey | PWVCMZGQEZUDNL-SWQDORGXSA-N |
| XLogP | 0.35 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |