C20H22F3N7O4 — CID 44601590
(2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 44601590) has the molecular formula C20H22F3N7O4 and a molecular weight of 481.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 44601590 |
| Molecular Formula | C20H22F3N7O4 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNC(=O)[C@@H](N)Cc2ccc(C(F)(F)F)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H22F3N7O4/c21-20(22,23)10-3-1-9(2-4-10)5-11(24)18(33)26-6-12-14(31)15(32)19(34-12)30-8-29-13-16(25)27-7-28-17(13)30/h1-4,7-8,11-12,14-15,19,31-32H,5-6,24H2,(H,26,33)(H2,25,27,28)/t11-,12+,14+,15+,19+/m0/s1 |
| InChIKey | WAIWQEPZCBJCFB-QTOWJTHWSA-N |
| XLogP | -0.27 |
| TPSA | 174.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |