C19H23N7O4 — CID 44601593
(2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-phenylpropanamide (PubChem CID 44601593) has the molecular formula C19H23N7O4 and a molecular weight of 413.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 44601593 |
| Molecular Formula | C19H23N7O4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-phenylpropanamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNC(=O)[C@@H](N)Cc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23N7O4/c20-11(6-10-4-2-1-3-5-10)18(29)22-7-12-14(27)15(28)19(30-12)26-9-25-13-16(21)23-8-24-17(13)26/h1-5,8-9,11-12,14-15,19,27-28H,6-7,20H2,(H,22,29)(H2,21,23,24)/t11-,12+,14+,15+,19+/m0/s1 |
| InChIKey | URZPVGALEPLQFQ-QTOWJTHWSA-N |
| XLogP | -1.29 |
| TPSA | 174.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |