C21H24N6O6 — CID 118074007
[2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-acetamido-3-phenylpropanoate (PubChem CID 118074007) has the molecular formula C21H24N6O6 and a molecular weight of 456.46 g/mol. Its IUPAC name is [2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-acetamido-3-phenylpropanoate.
| Compound Name | [2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 118074007 |
| Molecular Formula | C21H24N6O6 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-acetamido-3-phenylpropanoate |
| SMILES | CC(=O)N[C@H](Cc1ccccc1)C(=O)OC1C(O)C(CO)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H24N6O6/c1-11(29)26-13(7-12-5-3-2-4-6-12)21(31)33-17-16(30)14(8-28)32-20(17)27-10-25-15-18(22)23-9-24-19(15)27/h2-6,9-10,13-14,16-17,20,28,30H,7-8H2,1H3,(H,26,29)(H2,22,23,24)/t13-,14?,16?,17?,20?/m1/s1 |
| InChIKey | URWOATHFLHPANF-CSXKAYCRSA-N |
| XLogP | -0.68 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |