C14H20N6O5S2 — CID 118074032
[2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-amino-3-(methyldisulfanyl)propanoate (PubChem CID 118074032) has the molecular formula C14H20N6O5S2 and a molecular weight of 416.49 g/mol. Its IUPAC name is [2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-amino-3-(methyldisulfanyl)propanoate.
| Compound Name | [2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-amino-3-(methyldisulfanyl)propanoate |
|---|---|
| PubChem CID | 118074032 |
| Molecular Formula | C14H20N6O5S2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] (2R)-2-amino-3-(methyldisulfanyl)propanoate |
| SMILES | CSSC[C@H](N)C(=O)OC1C(O)C(CO)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H20N6O5S2/c1-26-27-3-6(15)14(23)25-10-9(22)7(2-21)24-13(10)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,2-3,15H2,1H3,(H2,16,17,18)/t6-,7?,9?,10?,13?/m0/s1 |
| InChIKey | SNURIIVZIAKRRI-SKFCKBNESA-N |
| XLogP | -1.09 |
| TPSA | 171.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|