C15H22N6O5S2 — CID 72699755
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-amino-4-(methyldisulfanyl)butanoate (PubChem CID 72699755) has the molecular formula C15H22N6O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-amino-4-(methyldisulfanyl)butanoate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-amino-4-(methyldisulfanyl)butanoate |
|---|---|
| PubChem CID | 72699755 |
| Molecular Formula | C15H22N6O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-amino-4-(methyldisulfanyl)butanoate |
| SMILES | CSSCCC(N)C(=O)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H22N6O5S2/c1-27-28-3-2-7(16)15(24)26-11-10(23)8(4-22)25-14(11)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2,17,18,19)/t7?,8-,10-,11-,14-/m1/s1 |
| InChIKey | PLASWLQDMAJVJM-HVMNINKTSA-N |
| XLogP | -0.70 |
| TPSA | 171.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|