C16H26N6O6S — CID 174538139
2-amino-4-ethylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 174538139) has the molecular formula C16H26N6O6S and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-amino-4-ethylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-amino-4-ethylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174538139 |
| Molecular Formula | C16H26N6O6S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-amino-4-ethylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCSCCC(N)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N5O4.C6H13NO2S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-2-10-4-3-5(7)6(8)9/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);5H,2-4,7H2,1H3,(H,8,9)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | OLACRQVQSSWQFO-MCDZGGTQSA-N |
| XLogP | -1.44 |
| TPSA | 202.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|