C11H15N5O6S — CID 56977453
[(2R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 56977453) has the molecular formula C11H15N5O6S and a molecular weight of 345.34 g/mol. Its IUPAC name is [(2R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 56977453 |
| Molecular Formula | C11H15N5O6S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | [(2R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C(O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H15N5O6S/c1-23(19,20)22-8-7(18)5(2-17)21-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7?,8?,11-/m1/s1 |
| InChIKey | ZRXKBYOZGUWWRN-VTFQDDHLSA-N |
| XLogP | -2.00 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|