C11H14ClN5O6S — CID 4269989
[2-(2-amino-6-chloropurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 4269989) has the molecular formula C11H14ClN5O6S and a molecular weight of 379.78 g/mol. Its IUPAC name is [2-(2-amino-6-chloropurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [2-(2-amino-6-chloropurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 4269989 |
| Molecular Formula | C11H14ClN5O6S |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | [2-(2-amino-6-chloropurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C(O)C(CO)OC1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C11H14ClN5O6S/c1-24(20,21)23-7-6(19)4(2-18)22-10(7)17-3-14-5-8(12)15-11(13)16-9(5)17/h3-4,6-7,10,18-19H,2H2,1H3,(H2,13,15,16) |
| InChIKey | ORXWNPDCIZNLHC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|