C12H18N6O4S — CID 131863288
(2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol (PubChem CID 131863288) has the molecular formula C12H18N6O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol |
|---|---|
| PubChem CID | 131863288 |
| Molecular Formula | C12H18N6O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol |
| SMILES | CSCO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C12H18N6O4S/c1-23-4-21-8-7(20)5(2-19)22-11(8)18-3-15-6-9(13)16-12(14)17-10(6)18/h3,5,7-8,11,19-20H,2,4H2,1H3,(H4,13,14,16,17)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | MUEPLXHODQBLTM-IOSLPCCCSA-N |
| XLogP | -1.05 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|