C11H16N6O3 — CID 134240596
(3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyloxolane-3,4-diol (PubChem CID 134240596) has the molecular formula C11H16N6O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyloxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyloxolane-3,4-diol |
|---|---|
| PubChem CID | 134240596 |
| Molecular Formula | C11H16N6O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyloxolane-3,4-diol |
| SMILES | CC[C@H]1OC(n2cnc3c(N)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H16N6O3/c1-2-4-6(18)7(19)10(20-4)17-3-14-5-8(12)15-11(13)16-9(5)17/h3-4,6-7,10,18-19H,2H2,1H3,(H4,12,13,15,16)/t4-,6-,7-,10?/m1/s1 |
| InChIKey | OEMJVUADXJHBNN-VTHZCTBJSA-N |
| XLogP | -0.98 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |