C11H16N6O4 — CID 69050482
(2R,5R)-2-(2,6-diaminopurin-9-yl)-5-(methoxymethyl)oxolane-3,4-diol (PubChem CID 69050482) has the molecular formula C11H16N6O4 and a molecular weight of 296.29 g/mol. Its IUPAC name is (2R,5R)-2-(2,6-diaminopurin-9-yl)-5-(methoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(2,6-diaminopurin-9-yl)-5-(methoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69050482 |
| Molecular Formula | C11H16N6O4 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2R,5R)-2-(2,6-diaminopurin-9-yl)-5-(methoxymethyl)oxolane-3,4-diol |
| SMILES | COC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)C(O)C1O |
| InChI | InChI=1S/C11H16N6O4/c1-20-2-4-6(18)7(19)10(21-4)17-3-14-5-8(12)15-11(13)16-9(5)17/h3-4,6-7,10,18-19H,2H2,1H3,(H4,12,13,15,16)/t4-,6?,7?,10-/m1/s1 |
| InChIKey | NIEXRHDWTVTIFO-DGPXGRDGSA-N |
| XLogP | -1.74 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |