C14H19N8O6P — CID 101065567
[(2R,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-methylimidazol-1-yl)phosphinic acid (PubChem CID 101065567) has the molecular formula C14H19N8O6P and a molecular weight of 426.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-methylimidazol-1-yl)phosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-methylimidazol-1-yl)phosphinic acid |
|---|---|
| PubChem CID | 101065567 |
| Molecular Formula | C14H19N8O6P |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-methylimidazol-1-yl)phosphinic acid |
| SMILES | Cc1nccn1P(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19N8O6P/c1-6-17-2-3-22(6)29(25,26)27-4-7-9(23)10(24)13(28-7)21-5-18-8-11(15)19-14(16)20-12(8)21/h2-3,5,7,9-10,13,23-24H,4H2,1H3,(H,25,26)(H4,15,16,19,20)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | VDKWZEWHKVPOQP-QYVSTXNMSA-N |
| XLogP | -1.22 |
| TPSA | 209.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|