C14H18N7O6P — CID 14370214
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylimidazol-1-yl)phosphinic acid (PubChem CID 14370214) has the molecular formula C14H18N7O6P and a molecular weight of 411.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylimidazol-1-yl)phosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylimidazol-1-yl)phosphinic acid |
|---|---|
| PubChem CID | 14370214 |
| Molecular Formula | C14H18N7O6P |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylimidazol-1-yl)phosphinic acid |
| SMILES | Cc1cn(P(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cn1 |
| InChI | InChI=1S/C14H18N7O6P/c1-7-2-20(5-18-7)28(24,25)26-3-8-10(22)11(23)14(27-8)21-6-19-9-12(15)16-4-17-13(9)21/h2,4-6,8,10-11,14,22-23H,3H2,1H3,(H,24,25)(H2,15,16,17)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | BMHWERZXJAFVDG-IDTAVKCVSA-N |
| XLogP | -0.80 |
| TPSA | 183.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|