C10H14FLiN5O7P — CID 173126813
lithium;[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride (PubChem CID 173126813) has the molecular formula C10H14FLiN5O7P and a molecular weight of 373.16 g/mol. Its IUPAC name is lithium;[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride.
| Compound Name | lithium;[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 173126813 |
| Molecular Formula | C10H14FLiN5O7P |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | lithium;[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H]1O.[H-].[Li+] |
| InChI | InChI=1S/C10H13FN5O7P.Li.H/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(18)5(17)3(23-9)1-22-24(19,20)21;;/h2-3,5-6,9,17-18H,1H2,(H2,12,14,15)(H2,19,20,21);;/q;+1;-1/t3-,5-,6+,9-;;/m1../s1 |
| InChIKey | UWXMXSQGNPIDPS-KKNRVDJNSA-N |
| XLogP | -4.61 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|