C10H15N6O8PS — CID 18645682
[(2R,3S,4R,5R)-5-(2-amino-6-sulfinamoylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 18645682) has the molecular formula C10H15N6O8PS and a molecular weight of 410.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-sulfinamoylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-sulfinamoylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 18645682 |
| Molecular Formula | C10H15N6O8PS |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-sulfinamoylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(S(N)=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H15N6O8PS/c11-10-14-7-4(8(15-10)26(12)22)13-2-16(7)9-6(18)5(17)3(24-9)1-23-25(19,20)21/h2-3,5-6,9,17-18H,1,12H2,(H2,11,14,15)(H2,19,20,21)/t3-,5-,6-,9-,26?/m1/s1 |
| InChIKey | OBSSJLMXZVVBGA-MPDCTDBASA-N |
| XLogP | -2.88 |
| TPSA | 229.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|