C11H16N5O6PS — CID 87391881
[(2R,3R,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 87391881) has the molecular formula C11H16N5O6PS and a molecular weight of 377.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87391881 |
| Molecular Formula | C11H16N5O6PS |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3S)c2n1 |
| InChI | InChI=1S/C11H16N5O6PS/c1-4-14-9(12)6-10(15-4)16(3-13-6)11-8(24)7(17)5(22-11)2-21-23(18,19)20/h3,5,7-8,11,17,24H,2H2,1H3,(H2,12,14,15)(H2,18,19,20)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | KJEIVNIICCEMEV-IOSLPCCCSA-N |
| XLogP | -0.62 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|