C16H18N5O7P — CID 57219751
[(2R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 57219751) has the molecular formula C16H18N5O7P and a molecular weight of 423.32 g/mol. Its IUPAC name is [(2R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 57219751 |
| Molecular Formula | C16H18N5O7P |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [(2R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(-c2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C16H18N5O7P/c17-13-10-15(20-14(19-13)8-4-2-1-3-5-8)21(7-18-10)16-12(23)11(22)9(28-16)6-27-29(24,25)26/h1-5,7,9,11-12,16,22-23H,6H2,(H2,17,19,20)(H2,24,25,26)/t9-,11?,12?,16-/m1/s1 |
| InChIKey | RXPNERVJFZJFDP-ZDAQOXLSSA-N |
| XLogP | -0.20 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|