C18H18N5O7P — CID 46877350
[(2R,3S,4R)-5-[6-amino-2-(2-phenylethynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 46877350) has the molecular formula C18H18N5O7P and a molecular weight of 447.34 g/mol. Its IUPAC name is [(2R,3S,4R)-5-[6-amino-2-(2-phenylethynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-5-[6-amino-2-(2-phenylethynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 46877350 |
| Molecular Formula | C18H18N5O7P |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [(2R,3S,4R)-5-[6-amino-2-(2-phenylethynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(C#Cc2ccccc2)nc2c1ncn2C1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18N5O7P/c19-16-13-17(22-12(21-16)7-6-10-4-2-1-3-5-10)23(9-20-13)18-15(25)14(24)11(30-18)8-29-31(26,27)28/h1-5,9,11,14-15,18,24-25H,8H2,(H2,19,21,22)(H2,26,27,28)/t11-,14-,15-,18?/m1/s1 |
| InChIKey | IFWPKQUPHSOILY-HETNKJQDSA-N |
| XLogP | -0.46 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|