C17H19N6Na2O7P — CID 10206962
disodium;[(2R,3S,4R,5R)-5-[6-amino-2-(6-cyanohex-1-ynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 10206962) has the molecular formula C17H19N6Na2O7P and a molecular weight of 496.33 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-5-[6-amino-2-(6-cyanohex-1-ynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-5-[6-amino-2-(6-cyanohex-1-ynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 10206962 |
| Molecular Formula | C17H19N6Na2O7P |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-5-[6-amino-2-(6-cyanohex-1-ynyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | N#CCCCCC#Cc1nc(N)c2ncn([C@@H]3O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1.[Na+].[Na+] |
| InChI | InChI=1S/C17H21N6O7P.2Na/c18-7-5-3-1-2-4-6-11-21-15(19)12-16(22-11)23(9-20-12)17-14(25)13(24)10(30-17)8-29-31(26,27)28;;/h9-10,13-14,17,24-25H,1-3,5,8H2,(H2,19,21,22)(H2,26,27,28);;/q;2*+1/p-2/t10-,13-,14-,17-;;/m1../s1 |
| InChIKey | LWIBGTFMUSCKFM-XBLNUSFOSA-L |
| XLogP | -7.68 |
| TPSA | 215.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | -7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|