C16H20N8O3 — CID 91120128
(2R,5R)-2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(azidomethyl)oxolane-3,4-diol (PubChem CID 91120128) has the molecular formula C16H20N8O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is (2R,5R)-2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(azidomethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(azidomethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91120128 |
| Molecular Formula | C16H20N8O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2R,5R)-2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(azidomethyl)oxolane-3,4-diol |
| SMILES | CCCCC#Cc1nc(N)c2ncn([C@@H]3O[C@H](CN=[N+]=[N-])C(O)C3O)c2n1 |
| InChI | InChI=1S/C16H20N8O3/c1-2-3-4-5-6-10-21-14(17)11-15(22-10)24(8-19-11)16-13(26)12(25)9(27-16)7-20-23-18/h8-9,12-13,16,25-26H,2-4,7H2,1H3,(H2,17,21,22)/t9-,12?,13?,16-/m1/s1 |
| InChIKey | PIULGPMTTHBMPT-RCLQZVNMSA-N |
| XLogP | 0.88 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|