C18H25N7O4 — CID 14999743
1-[[(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-methylurea (PubChem CID 14999743) has the molecular formula C18H25N7O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-[[(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-methylurea.
| Compound Name | 1-[[(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-methylurea |
|---|---|
| PubChem CID | 14999743 |
| Molecular Formula | C18H25N7O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[[(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-methylurea |
| SMILES | CCCCC#Cc1nc(N)c2ncn([C@@H]3O[C@H](CNC(=O)NC)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C18H25N7O4/c1-3-4-5-6-7-11-23-15(19)12-16(24-11)25(9-22-12)17-14(27)13(26)10(29-17)8-21-18(28)20-2/h9-10,13-14,17,26-27H,3-5,8H2,1-2H3,(H2,19,23,24)(H2,20,21,28)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | OSTXQEXLPPTHSC-IWCJZZDYSA-N |
| XLogP | -0.50 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|