C18H24N5Na2O7P — CID 10117739
disodium;[(2R,3S,4R,5R)-5-(6-amino-2-oct-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 10117739) has the molecular formula C18H24N5Na2O7P and a molecular weight of 499.37 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-5-(6-amino-2-oct-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-5-(6-amino-2-oct-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 10117739 |
| Molecular Formula | C18H24N5Na2O7P |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-5-(6-amino-2-oct-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | CCCCCCC#Cc1nc(N)c2ncn([C@@H]3O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1.[Na+].[Na+] |
| InChI | InChI=1S/C18H26N5O7P.2Na/c1-2-3-4-5-6-7-8-12-21-16(19)13-17(22-12)23(10-20-13)18-15(25)14(24)11(30-18)9-29-31(26,27)28;;/h10-11,14-15,18,24-25H,2-6,9H2,1H3,(H2,19,21,22)(H2,26,27,28);;/q;2*+1/p-2/t11-,14-,15-,18-;;/m1../s1 |
| InChIKey | ASCKQNTWCFJKCO-RLGRXUDSSA-L |
| XLogP | -6.80 |
| TPSA | 191.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | -6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|