C17H21ClN6O4 — CID 10024452
(2S,3S,4R,5R)-5-[6-amino-2-(5-chloropent-1-ynyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 10024452) has the molecular formula C17H21ClN6O4 and a molecular weight of 408.85 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-(5-chloropent-1-ynyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-(5-chloropent-1-ynyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10024452 |
| Molecular Formula | C17H21ClN6O4 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-(5-chloropent-1-ynyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCCCCl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H21ClN6O4/c1-2-20-16(27)13-11(25)12(26)17(28-13)24-8-21-10-14(19)22-9(23-15(10)24)6-4-3-5-7-18/h8,11-13,17,25-26H,2-3,5,7H2,1H3,(H,20,27)(H2,19,22,23)/t11-,12+,13-,17+/m0/s1 |
| InChIKey | DFVOGXXNMGOAJH-PFHKOEEOSA-N |
| XLogP | -0.47 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|