C22H30N8O6 — CID 163459450
ethyl 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperazine-1-carboxylate (PubChem CID 163459450) has the molecular formula C22H30N8O6 and a molecular weight of 502.53 g/mol. Its IUPAC name is ethyl 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163459450 |
| Molecular Formula | C22H30N8O6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | ethyl 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperazine-1-carboxylate |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCN4CCN(C(=O)OCC)CC4)nc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H30N8O6/c1-3-24-20(33)17-15(31)16(32)21(36-17)30-12-25-14-18(23)26-13(27-19(14)30)6-5-7-28-8-10-29(11-9-28)22(34)35-4-2/h12,15-17,21,31-32H,3-4,7-11H2,1-2H3,(H,24,33)(H2,23,26,27)/t15-,16+,17+,21-/m1/s1 |
| InChIKey | BNILZKARUZOLTJ-MXTNKPTQSA-N |
| XLogP | -1.71 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|