C27H31N7O6 — CID 23582049
phenyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 23582049) has the molecular formula C27H31N7O6 and a molecular weight of 549.59 g/mol. Its IUPAC name is phenyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | phenyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23582049 |
| Molecular Formula | C27H31N7O6 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | phenyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCC4CCN(C(=O)Oc5ccccc5)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H31N7O6/c1-2-29-25(37)22-20(35)21(36)26(40-22)34-15-30-19-23(28)31-18(32-24(19)34)10-6-7-16-11-13-33(14-12-16)27(38)39-17-8-4-3-5-9-17/h3-5,8-9,15-16,20-22,26,35-36H,2,7,11-14H2,1H3,(H,29,37)(H2,28,31,32)/t20-,21+,22-,26+/m0/s1 |
| InChIKey | AGLCFTPEAPMTLE-IMIIHFCZSA-N |
| XLogP | 0.82 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|