C25H33N7O6 — CID 25094288
cyclopropylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 25094288) has the molecular formula C25H33N7O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is cyclopropylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | cyclopropylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25094288 |
| Molecular Formula | C25H33N7O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | cyclopropylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCC4CCN(C(=O)OCC5CC5)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H33N7O6/c1-2-27-23(35)20-18(33)19(34)24(38-20)32-13-28-17-21(26)29-16(30-22(17)32)5-3-4-14-8-10-31(11-9-14)25(36)37-12-15-6-7-15/h13-15,18-20,24,33-34H,2,4,6-12H2,1H3,(H,27,35)(H2,26,29,30)/t18-,19+,20-,24+/m0/s1 |
| InChIKey | NTNFCHLHFHQWII-CMCWBKRRSA-N |
| XLogP | 0.16 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|