C27H35N7O6 — CID 25093737
cyclobutylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 25093737) has the molecular formula C27H35N7O6 and a molecular weight of 553.62 g/mol. Its IUPAC name is cyclobutylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | cyclobutylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25093737 |
| Molecular Formula | C27H35N7O6 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | cyclobutylmethyl 4-[3-[6-amino-9-[(2R,3R,4S,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | Nc1nc(C#CCC2CCN(C(=O)OCC3CCC3)CC2)nc2c1ncn2[C@@H]1O[C@H](C(=O)NC2CC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H35N7O6/c28-23-19-24(34(14-29-19)26-21(36)20(35)22(40-26)25(37)30-17-7-8-17)32-18(31-23)6-2-3-15-9-11-33(12-10-15)27(38)39-13-16-4-1-5-16/h14-17,20-22,26,35-36H,1,3-5,7-13H2,(H,30,37)(H2,28,31,32)/t20-,21+,22-,26+/m0/s1 |
| InChIKey | MLCNZQCHJMIIAR-IMIIHFCZSA-N |
| XLogP | 0.70 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|