C22H29N7O5 — CID 59716266
(2S,4S,5R)-5-[2-[3-(1-acetylpiperidin-4-yl)prop-1-ynyl]-6-aminopurin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 59716266) has the molecular formula C22H29N7O5 and a molecular weight of 471.52 g/mol. Its IUPAC name is (2S,4S,5R)-5-[2-[3-(1-acetylpiperidin-4-yl)prop-1-ynyl]-6-aminopurin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,4S,5R)-5-[2-[3-(1-acetylpiperidin-4-yl)prop-1-ynyl]-6-aminopurin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 59716266 |
| Molecular Formula | C22H29N7O5 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2S,4S,5R)-5-[2-[3-(1-acetylpiperidin-4-yl)prop-1-ynyl]-6-aminopurin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCC4CCN(C(C)=O)CC4)nc32)[C@@H](O)C1O |
| InChI | InChI=1S/C22H29N7O5/c1-3-24-21(33)18-16(31)17(32)22(34-18)29-11-25-15-19(23)26-14(27-20(15)29)6-4-5-13-7-9-28(10-8-13)12(2)30/h11,13,16-18,22,31-32H,3,5,7-10H2,1-2H3,(H,24,33)(H2,23,26,27)/t16?,17-,18-,22+/m0/s1 |
| InChIKey | RMDBGNCKYJNLPY-DMBUIRNCSA-N |
| XLogP | -0.84 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|