C22H30N6O5 — CID 67280790
5-[6-amino-2-[3-[4-(hydroxymethyl)cyclohexyl]prop-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 67280790) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is 5-[6-amino-2-[3-[4-(hydroxymethyl)cyclohexyl]prop-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | 5-[6-amino-2-[3-[4-(hydroxymethyl)cyclohexyl]prop-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 67280790 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 5-[6-amino-2-[3-[4-(hydroxymethyl)cyclohexyl]prop-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)C1OC(n2cnc3c(N)nc(C#CCC4CCC(CO)CC4)nc32)C(O)C1O |
| InChI | InChI=1S/C22H30N6O5/c1-2-24-21(32)18-16(30)17(31)22(33-18)28-11-25-15-19(23)26-14(27-20(15)28)5-3-4-12-6-8-13(10-29)9-7-12/h11-13,16-18,22,29-31H,2,4,6-10H2,1H3,(H,24,32)(H2,23,26,27) |
| InChIKey | HDZFEZHFXYFXTG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|