C32H47N7O7 — CID 143833431
[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 143833431) has the molecular formula C32H47N7O7 and a molecular weight of 641.77 g/mol. Its IUPAC name is [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143833431 |
| Molecular Formula | C32H47N7O7 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 4-[3-[6-amino-9-[(2R,3S,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | CCC(C)(C)OCCC(C)(C)OC(=O)N1CCC(CC#Cc2nc(N)c3ncn([C@@H]4O[C@H](C(=O)NC5CC5)[C@H](O)[C@@H]4O)c3n2)CC1 |
| InChI | InChI=1S/C32H47N7O7/c1-6-31(2,3)44-17-14-32(4,5)46-30(43)38-15-12-19(13-16-38)8-7-9-21-36-26(33)22-27(37-21)39(18-34-22)29-24(41)23(40)25(45-29)28(42)35-20-10-11-20/h18-20,23-25,29,40-41H,6,8,10-17H2,1-5H3,(H,35,42)(H2,33,36,37)/t23-,24+,25+,29-/m1/s1 |
| InChIKey | NJUQTHJWQRXTNC-XHHBKWMTSA-N |
| XLogP | 2.27 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|