C21H28N6O6 — CID 10344230
(2S,3S,4R,5R)-5-[6-amino-2-[4-(oxan-2-yloxy)but-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 10344230) has the molecular formula C21H28N6O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[4-(oxan-2-yloxy)but-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[4-(oxan-2-yloxy)but-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10344230 |
| Molecular Formula | C21H28N6O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[4-(oxan-2-yloxy)but-1-ynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCCOC4CCCCO4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H28N6O6/c1-2-23-20(30)17-15(28)16(29)21(33-17)27-11-24-14-18(22)25-12(26-19(14)27)7-3-5-9-31-13-8-4-6-10-32-13/h11,13,15-17,21,28-29H,2,4-6,8-10H2,1H3,(H,23,30)(H2,22,25,26)/t13?,15-,16+,17-,21+/m0/s1 |
| InChIKey | VOMLRNBXQTXTLE-BASJXEDTSA-N |
| XLogP | -0.55 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|