C17H23N5O3S — CID 22016781
2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 22016781) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | 2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 22016781 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-(6-amino-2-hex-1-ynylpurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CCCCC#Cc1nc(N)c2ncn(C3OC(CSC)C(O)C3O)c2n1 |
| InChI | InChI=1S/C17H23N5O3S/c1-3-4-5-6-7-11-20-15(18)12-16(21-11)22(9-19-12)17-14(24)13(23)10(25-17)8-26-2/h9-10,13-14,17,23-24H,3-5,8H2,1-2H3,(H2,18,20,21) |
| InChIKey | DZVQSQRNHKKZLJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|